Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Sodium bromate, 99.5% (metals basis)
CAS: 7789-38-0 Molecular Formula: BrNaO3 Molecular Weight (g/mol): 150.891 MDL Number: MFCD00003476 InChI Key: XUXNAKZDHHEHPC-UHFFFAOYSA-M Synonym: sodium bromate,bromic acid, sodium salt,dyetone,bromate de sodium,sodium bromate dot,neutralizer k-126,neutralizer k-140,neutralizer k-938,sodium bromate nabro3,bromate de sodium french PubChem CID: 23668195 ChEBI: CHEBI:75229 IUPAC Name: sodium;bromate SMILES: [O-]Br(=O)=O.[Na+]
| PubChem CID | 23668195 |
|---|---|
| CAS | 7789-38-0 |
| Molecular Weight (g/mol) | 150.891 |
| ChEBI | CHEBI:75229 |
| MDL Number | MFCD00003476 |
| SMILES | [O-]Br(=O)=O.[Na+] |
| Synonym | sodium bromate,bromic acid, sodium salt,dyetone,bromate de sodium,sodium bromate dot,neutralizer k-126,neutralizer k-140,neutralizer k-938,sodium bromate nabro3,bromate de sodium french |
| IUPAC Name | sodium;bromate |
| InChI Key | XUXNAKZDHHEHPC-UHFFFAOYSA-M |
| Molecular Formula | BrNaO3 |
Copper(II) nitrate hydrate, Puratronic™, 99.999% (metals basis)
CAS: 13778-31-9 Molecular Formula: CuN2O6 Molecular Weight (g/mol): 187.55 MDL Number: MFCD00149669 InChI Key: XTVVROIMIGLXTD-UHFFFAOYSA-N Synonym: copper ii nitrate hydrate,copper nitrate hydrate,acmc-20aldm,cupric nitrate hydrate,cu.2no3.h2o,copper 2+ ion hydrate dinitrate,copper 2+ hydrate dinitrate,copper ii nitrate hydrate, puratronic,copper 2+ nitrate-water 1/2/1,nitric acid, copper 2+ salt, hydrate 8ci,9ci PubChem CID: 15303652 SMILES: [Cu++].[O-][N+]([O-])=O.[O-][N+]([O-])=O
| PubChem CID | 15303652 |
|---|---|
| CAS | 13778-31-9 |
| Molecular Weight (g/mol) | 187.55 |
| MDL Number | MFCD00149669 |
| SMILES | [Cu++].[O-][N+]([O-])=O.[O-][N+]([O-])=O |
| Synonym | copper ii nitrate hydrate,copper nitrate hydrate,acmc-20aldm,cupric nitrate hydrate,cu.2no3.h2o,copper 2+ ion hydrate dinitrate,copper 2+ hydrate dinitrate,copper ii nitrate hydrate, puratronic,copper 2+ nitrate-water 1/2/1,nitric acid, copper 2+ salt, hydrate 8ci,9ci |
| InChI Key | XTVVROIMIGLXTD-UHFFFAOYSA-N |
| Molecular Formula | CuN2O6 |
Indium foil, 2.0mm (0.08in) thick, Puratronic™, 99.998% (metals basis)
CAS: 7440-74-6 Molecular Formula: In Molecular Weight (g/mol): 114.82 MDL Number: MFCD00134048 InChI Key: APFVFJFRJDLVQX-UHFFFAOYSA-N Synonym: indium, elemental,unii-045a6v3vfx,powder,shot,powder,-100 mesh,indio,shot, tear drop, 4mm 0.2in,ingot, polycrystalline, puratronic,shot, 5mm 0.2in & down, puratronic,wire, 0.5mm 0.02in dia, puratronic PubChem CID: 5359967 ChEBI: CHEBI:30430 IUPAC Name: indium SMILES: [In]
| PubChem CID | 5359967 |
|---|---|
| CAS | 7440-74-6 |
| Molecular Weight (g/mol) | 114.82 |
| ChEBI | CHEBI:30430 |
| MDL Number | MFCD00134048 |
| SMILES | [In] |
| Synonym | indium, elemental,unii-045a6v3vfx,powder,shot,powder,-100 mesh,indio,shot, tear drop, 4mm 0.2in,ingot, polycrystalline, puratronic,shot, 5mm 0.2in & down, puratronic,wire, 0.5mm 0.02in dia, puratronic |
| IUPAC Name | indium |
| InChI Key | APFVFJFRJDLVQX-UHFFFAOYSA-N |
| Molecular Formula | In |
Yttrium(III) oxide, REacton™, 99.999% (REO)
CAS: 1314-36-9 Molecular Formula: O3Y2 Molecular Weight (g/mol): 225.81 MDL Number: MFCD00011473 InChI Key: RUDFQVOCFDJEEF-UHFFFAOYSA-N IUPAC Name: diyttrium(3+) trioxidandiide SMILES: [O--].[O--].[O--].[Y+3].[Y+3]
| CAS | 1314-36-9 |
|---|---|
| Molecular Weight (g/mol) | 225.81 |
| MDL Number | MFCD00011473 |
| SMILES | [O--].[O--].[O--].[Y+3].[Y+3] |
| IUPAC Name | diyttrium(3+) trioxidandiide |
| InChI Key | RUDFQVOCFDJEEF-UHFFFAOYSA-N |
| Molecular Formula | O3Y2 |
Zirconium dinitrate oxide hydrate, 99.9% (metals basis), Thermo Scientific Chemicals
CAS: 14985-18-3 Molecular Formula: N2O7Zr Molecular Weight (g/mol): 231.23 MDL Number: MFCD00149896 InChI Key: JWBWFTANBHYHBC-UHFFFAOYSA-N Synonym: zirconium dinitrate oxide hydrate,zirconyl nitrate hydrate,zirconium iv dinitrate oxide hydrate,oxozirconiumbis ylium hydrate dinitrate,zirconium iv oxynitrate hydrate,zirconium dinitrate oxide hydrate, puratronic,zirconium iv oxynitrate hydrate, technical grade,zirconium iv oxynitrate hydrate trace metals basis PubChem CID: 16211674 SMILES: [O-][N+](=O)O[Zr](=O)O[N+]([O-])=O
| PubChem CID | 16211674 |
|---|---|
| CAS | 14985-18-3 |
| Molecular Weight (g/mol) | 231.23 |
| MDL Number | MFCD00149896 |
| SMILES | [O-][N+](=O)O[Zr](=O)O[N+]([O-])=O |
| Synonym | zirconium dinitrate oxide hydrate,zirconyl nitrate hydrate,zirconium iv dinitrate oxide hydrate,oxozirconiumbis ylium hydrate dinitrate,zirconium iv oxynitrate hydrate,zirconium dinitrate oxide hydrate, puratronic,zirconium iv oxynitrate hydrate, technical grade,zirconium iv oxynitrate hydrate trace metals basis |
| InChI Key | JWBWFTANBHYHBC-UHFFFAOYSA-N |
| Molecular Formula | N2O7Zr |
Zinc Bromide 98.0+%, TCI America™
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 7699-45-8 Molecular Formula: Br2Zn Molecular Weight (g/mol): 225.188 MDL Number: MFCD00011294 InChI Key: VNDYJBBGRKZCSX-UHFFFAOYSA-L Synonym: zincbromide,zinc ii bromide,acmc-209p7h,zinc 2+ ion dibromide,ksc378m6n,zinc bromide hydrate, puratronic™,zinc bromide, anhydrous 100g PubChem CID: 10421208 IUPAC Name: zinc;dibromide SMILES: [Zn+2].[Br-].[Br-]
| PubChem CID | 10421208 |
|---|---|
| CAS | 7699-45-8 |
| Molecular Weight (g/mol) | 225.188 |
| MDL Number | MFCD00011294 |
| SMILES | [Zn+2].[Br-].[Br-] |
| Synonym | zincbromide,zinc ii bromide,acmc-209p7h,zinc 2+ ion dibromide,ksc378m6n,zinc bromide hydrate, puratronic™,zinc bromide, anhydrous 100g |
| IUPAC Name | zinc;dibromide |
| InChI Key | VNDYJBBGRKZCSX-UHFFFAOYSA-L |
| Molecular Formula | Br2Zn |
Magnesium Powder, Particle size about 0.06-0.3mm, MilliporeSigma™
CAS: 7439-95-4 Molecular Formula: Mg Molecular Weight (g/mol): 24.30 MDL Number: MFCD00085308 InChI Key: JLVVSXFLKOJNIY-UHFFFAOYSA-N Synonym: magnesio,sheet,powdered,magnesio italian,turnings,rieke's active,ribbon,unii-i38zp9992a,hsdb 654,nitrate, acs PubChem CID: 5462224 ChEBI: CHEBI:25107 IUPAC Name: magnesium SMILES: [Mg]
| PubChem CID | 5462224 |
|---|---|
| CAS | 7439-95-4 |
| Molecular Weight (g/mol) | 24.30 |
| ChEBI | CHEBI:25107 |
| MDL Number | MFCD00085308 |
| SMILES | [Mg] |
| Synonym | magnesio,sheet,powdered,magnesio italian,turnings,rieke's active,ribbon,unii-i38zp9992a,hsdb 654,nitrate, acs |
| IUPAC Name | magnesium |
| InChI Key | JLVVSXFLKOJNIY-UHFFFAOYSA-N |
| Molecular Formula | Mg |
Zinc tetrafluoroborate hydrate, Zn 18% min
CAS: 27860-83-9 Molecular Formula: B2F8Zn Molecular Weight (g/mol): 238.99 MDL Number: MFCD00150371 InChI Key: BUMIVIYHDVNOQE-UHFFFAOYSA-N Synonym: zinc tetrafluoroborate hydrate,2bf4.zn.h2o,zinc tetrafluoroborate-water 1/2/1,zinc 2+ hydrate ditetrafluoroborate,zinc 2+ ion hydrate ditetrafluoroborate,borate 1-,tetrafluoro-, zinc 2:1 , hexahydrate 9ci PubChem CID: 16212112 SMILES: [Zn++].F[B-](F)(F)F.F[B-](F)(F)F
| PubChem CID | 16212112 |
|---|---|
| CAS | 27860-83-9 |
| Molecular Weight (g/mol) | 238.99 |
| MDL Number | MFCD00150371 |
| SMILES | [Zn++].F[B-](F)(F)F.F[B-](F)(F)F |
| Synonym | zinc tetrafluoroborate hydrate,2bf4.zn.h2o,zinc tetrafluoroborate-water 1/2/1,zinc 2+ hydrate ditetrafluoroborate,zinc 2+ ion hydrate ditetrafluoroborate,borate 1-,tetrafluoro-, zinc 2:1 , hexahydrate 9ci |
| InChI Key | BUMIVIYHDVNOQE-UHFFFAOYSA-N |
| Molecular Formula | B2F8Zn |
Titanium(IV) oxide, rutile, 99.8% (metals basis)
CAS: 1317-80-2 Molecular Formula: O2Ti Molecular Weight (g/mol): 79.87 MDL Number: MFCD00011269,MFCD00210650 InChI Key: GWEVSGVZZGPLCZ-UHFFFAOYSA-N Synonym: titanium dioxide,titania,titanium iv oxide,rutile,anatase,brookite,titanium white,flamenco,hombitan,titafrance PubChem CID: 26042 ChEBI: CHEBI:32234 IUPAC Name: dioxotitanium SMILES: O=[Ti]=O
| PubChem CID | 26042 |
|---|---|
| CAS | 1317-80-2 |
| Molecular Weight (g/mol) | 79.87 |
| ChEBI | CHEBI:32234 |
| MDL Number | MFCD00011269,MFCD00210650 |
| SMILES | O=[Ti]=O |
| Synonym | titanium dioxide,titania,titanium iv oxide,rutile,anatase,brookite,titanium white,flamenco,hombitan,titafrance |
| IUPAC Name | dioxotitanium |
| InChI Key | GWEVSGVZZGPLCZ-UHFFFAOYSA-N |
| Molecular Formula | O2Ti |
Niobium(V) ethoxide, 99.9%, (trace metal basis)
CAS: 3236-82-6 Molecular Formula: C10H25NbO5 Molecular Weight (g/mol): 318.21 MDL Number: MFCD00015122 InChI Key: ZTILUDNICMILKJ-UHFFFAOYSA-N Synonym: niobium ethoxide,niobium 5+ ethanolate,ethanol, niobium 5+ salt,niobium 5+ ion pentakis ethoxide,pentaethoxyniobium,niobium pentaethoxide,ethanol, niobium 5+ salt 5:1,acmc-1cmht,niobium v pentaethoxide,ethanolate; niobium 5+ PubChem CID: 160675 SMILES: CCO[Nb](OCC)(OCC)(OCC)OCC
| PubChem CID | 160675 |
|---|---|
| CAS | 3236-82-6 |
| Molecular Weight (g/mol) | 318.21 |
| MDL Number | MFCD00015122 |
| SMILES | CCO[Nb](OCC)(OCC)(OCC)OCC |
| Synonym | niobium ethoxide,niobium 5+ ethanolate,ethanol, niobium 5+ salt,niobium 5+ ion pentakis ethoxide,pentaethoxyniobium,niobium pentaethoxide,ethanol, niobium 5+ salt 5:1,acmc-1cmht,niobium v pentaethoxide,ethanolate; niobium 5+ |
| InChI Key | ZTILUDNICMILKJ-UHFFFAOYSA-N |
| Molecular Formula | C10H25NbO5 |
Cupric Sulfate Pentahydrate, ≥99%, (Crystalline), MP Biomedicals
CAS: 7758-99-8 Molecular Formula: CuH10O9S Molecular Weight (g/mol): 249.68 MDL Number: MFCD00149681 InChI Key: JZCCFEFSEZPSOG-UHFFFAOYSA-L Synonym: copper ii sulfate pentahydrate,copper sulfate pentahydrate,cupric sulfate pentahydrate,blue vitriol,calcanthite,bluestone,copper 2+ sulfate pentahydrate,triangle,vencedor,blue copperas PubChem CID: 24463 ChEBI: CHEBI:31440 IUPAC Name: copper(2+) pentahydrate sulfate SMILES: O.O.O.O.O.[Cu++].[O-]S([O-])(=O)=O
| PubChem CID | 24463 |
|---|---|
| CAS | 7758-99-8 |
| Molecular Weight (g/mol) | 249.68 |
| ChEBI | CHEBI:31440 |
| MDL Number | MFCD00149681 |
| SMILES | O.O.O.O.O.[Cu++].[O-]S([O-])(=O)=O |
| Synonym | copper ii sulfate pentahydrate,copper sulfate pentahydrate,cupric sulfate pentahydrate,blue vitriol,calcanthite,bluestone,copper 2+ sulfate pentahydrate,triangle,vencedor,blue copperas |
| IUPAC Name | copper(2+) pentahydrate sulfate |
| InChI Key | JZCCFEFSEZPSOG-UHFFFAOYSA-L |
| Molecular Formula | CuH10O9S |
Calcium perchlorate tetrahydrate, pure
CAS: 15627-86-8 Molecular Formula: CaCl2O8·4H2O Molecular Weight (g/mol): 311.04 MDL Number: MFCD00191895
| CAS | 15627-86-8 |
|---|---|
| Molecular Weight (g/mol) | 311.04 |
| MDL Number | MFCD00191895 |
| Molecular Formula | CaCl2O8·4H2O |
Palladium on activated carbon, unreduced, 5% Pd
CAS: 7440-05-3 Molecular Formula: Pd Molecular Weight (g/mol): 106.42 MDL Number: MFCD00011167 MFCD03457879 MFCD03427452 MFCD03613602 MFCD03613603 MFCD03613604 MFCD03613605 MFCD06798745 InChI Key: KDLHZDBZIXYQEI-UHFFFAOYSA-N Synonym: black,on carbon,paladio,palladium/carbon,element,charcoal,palladium, element,palladex 600,on charcoal,palladium-activated carbon PubChem CID: 23938 ChEBI: CHEBI:33363 IUPAC Name: palladium SMILES: [Pd]
| PubChem CID | 23938 |
|---|---|
| CAS | 7440-05-3 |
| Molecular Weight (g/mol) | 106.42 |
| ChEBI | CHEBI:33363 |
| MDL Number | MFCD00011167 MFCD03457879 MFCD03427452 MFCD03613602 MFCD03613603 MFCD03613604 MFCD03613605 MFCD06798745 |
| SMILES | [Pd] |
| Synonym | black,on carbon,paladio,palladium/carbon,element,charcoal,palladium, element,palladex 600,on charcoal,palladium-activated carbon |
| IUPAC Name | palladium |
| InChI Key | KDLHZDBZIXYQEI-UHFFFAOYSA-N |
| Molecular Formula | Pd |
Tantalum powder, APS ^=2 micron, 99.9% (metals basis)
CAS: 7440-25-7 Molecular Formula: Ta Molecular Weight (g/mol): 180.95 MDL Number: MFCD00011252 InChI Key: GUVRBAGPIYLISA-UHFFFAOYSA-N Synonym: tantalum, elemental,hydride,tantalum-181,tantalum, metal and oxide dust,tantal,tantalum, metal,powder,foil,wire,rod PubChem CID: 23956 ChEBI: CHEBI:33348 IUPAC Name: tantalum SMILES: [Ta]
| PubChem CID | 23956 |
|---|---|
| CAS | 7440-25-7 |
| Molecular Weight (g/mol) | 180.95 |
| ChEBI | CHEBI:33348 |
| MDL Number | MFCD00011252 |
| SMILES | [Ta] |
| Synonym | tantalum, elemental,hydride,tantalum-181,tantalum, metal and oxide dust,tantal,tantalum, metal,powder,foil,wire,rod |
| IUPAC Name | tantalum |
| InChI Key | GUVRBAGPIYLISA-UHFFFAOYSA-N |
| Molecular Formula | Ta |
Boron tribromide, 99+%
CAS: 10294-33-4 Molecular Formula: BBr3 Molecular Weight (g/mol): 250.52 MDL Number: MFCD00011312 InChI Key: ILAHWRKJUDSMFH-UHFFFAOYSA-N Synonym: boron tribromide,borane, tribromo,boron bromide,tribromoboron,hsdb 327,tribromoboran,boron tribrornide,boron tri bromide,boron tri-bromide PubChem CID: 25134 IUPAC Name: tribromoborane SMILES: BrB(Br)Br
| PubChem CID | 25134 |
|---|---|
| CAS | 10294-33-4 |
| Molecular Weight (g/mol) | 250.52 |
| MDL Number | MFCD00011312 |
| SMILES | BrB(Br)Br |
| Synonym | boron tribromide,borane, tribromo,boron bromide,tribromoboron,hsdb 327,tribromoboran,boron tribrornide,boron tri bromide,boron tri-bromide |
| IUPAC Name | tribromoborane |
| InChI Key | ILAHWRKJUDSMFH-UHFFFAOYSA-N |
| Molecular Formula | BBr3 |